Products 3036581-84-4

CAS 3036581-84-4 is the registry number for N-(3-(4-Chlorophenyl)-3-(pyridin-2-yl)propyl)-N-methylnitrous amide, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.

Structural formula: {0} (CAS {1})

N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-N-methylnitrous amide (CAS 3036581-84-4) is a chemical compound with the molecular formula C15H16ClN3O and a molecular weight of 289.76 g/mol. IUPAC name: N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-N-methylnitrous amide. InChIKey: UPKPBUKPDRVYPK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16ClN3O
Molecular weight289.76 g/mol
IUPAC nameN-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-N-methylnitrous amide
InChIKeyUPKPBUKPDRVYPK-UHFFFAOYSA-N
SMILESCN(CCC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2)N=O

Computed by PubChem (NCBI)