CAS 3036604-59-5 is the registry number for CDK2 degrader 1, 99.74%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10mM/1mL, 25 mg, 100 mg, 50 mg, 10 mg.
[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate (CAS 3036604-59-5) is a chemical compound with the molecular formula C23H27F2N3O4 and a molecular weight of 447.5 g/mol. IUPAC name: [(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate. InChIKey: KUTYUVCSHRYCRH-QYCFJQJSSA-N.
| Molecular formula | C23H27F2N3O4 |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | [(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate |
| InChIKey | KUTYUVCSHRYCRH-QYCFJQJSSA-N |
| SMILES | C1C[C@@H]2C[C@H]1C[C@H]2COC(=O)NC3CN(C3)C4=CC(=C(C(=C4)F)C5CCC(=O)NC5=O)F |
Computed by PubChem (NCBI)