Products 3036606-14-8
CAS 3036606-14-8 is the registry number for 4-[2,6-Bis(benzyloxy)pyridin-3-yl]benzoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[2,6-bis(phenylmethoxy)-3-pyridinyl]benzoic acid (CAS 3036606-14-8) is a chemical compound with the molecular formula C26H21NO4 and a molecular weight of 411.4 g/mol. IUPAC name: 4-[2,6-bis(phenylmethoxy)-3-pyridinyl]benzoic acid. InChIKey: GQVNYTQRIQEQTE-UHFFFAOYSA-N.
| Molecular formula | C26H21NO4 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | 4-[2,6-bis(phenylmethoxy)-3-pyridinyl]benzoic acid |
| InChIKey | GQVNYTQRIQEQTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=C(C=C2)C3=CC=C(C=C3)C(=O)O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)