CAS 3036649-51-8 is the registry number for RNase L ligand 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[3-(3-aminothiophen-2-yl)phenyl]phenyl]methyl-methylamino]-N-methyl-2-phenylacetamide (CAS 3036649-51-8) is a chemical compound with the molecular formula C27H27N3OS and a molecular weight of 441.6 g/mol. IUPAC name: (2S)-2-[[4-[3-(3-aminothiophen-2-yl)phenyl]phenyl]methyl-methylamino]-N-methyl-2-phenylacetamide. InChIKey: STFBMLYEUHZNGW-VWLOTQADSA-N.
| Molecular formula | C27H27N3OS |
|---|---|
| Molecular weight | 441.6 g/mol |
| IUPAC name | (2S)-2-[[4-[3-(3-aminothiophen-2-yl)phenyl]phenyl]methyl-methylamino]-N-methyl-2-phenylacetamide |
| InChIKey | STFBMLYEUHZNGW-VWLOTQADSA-N |
| SMILES | CNC(=O)[C@H](C1=CC=CC=C1)N(C)CC2=CC=C(C=C2)C3=CC(=CC=C3)C4=C(C=CS4)N |
Computed by PubChem (NCBI)