Products 3036895-67-4
CAS 3036895-67-4 is the registry number for AhR agonist 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
(7-fluoro-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-yl)-(1H-indazol-3-yl)methanone (CAS 3036895-67-4) is a chemical compound with the molecular formula C17H15FN4O and a molecular weight of 310.33 g/mol. IUPAC name: (7-fluoro-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-yl)-(1H-indazol-3-yl)methanone. InChIKey: USDJEKDASUHKAI-UHFFFAOYSA-N.
| Molecular formula | C17H15FN4O |
|---|---|
| Molecular weight | 310.33 g/mol |
| IUPAC name | (7-fluoro-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-yl)-(1H-indazol-3-yl)methanone |
| InChIKey | USDJEKDASUHKAI-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C(N1)C=CC(=C2)F)C(=O)C3=NNC4=CC=CC=C43 |
Computed by PubChem (NCBI)
Synonyms:
AhR agonist 8, orb2663572