CAS 3037649-95-6 is the registry number for ethyl (1S,4S)-3-oxo-2-azabicyclo[2.2.1]heptane-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Ethyl (1S,4S)-3-oxo-2-azabicyclo[2.2.1]heptane-4-carboxylate (CAS 3037649-95-6) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: ethyl (1S,4S)-3-oxo-2-azabicyclo[2.2.1]heptane-4-carboxylate. InChIKey: JNUZJHKSZQLTQM-RCOVLWMOSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | ethyl (1S,4S)-3-oxo-2-azabicyclo[2.2.1]heptane-4-carboxylate |
| InChIKey | JNUZJHKSZQLTQM-RCOVLWMOSA-N |
| SMILES | CCOC(=O)[C@@]12CC[C@@H](C1)NC2=O |
Computed by PubChem (NCBI)