Products 3037693-01-6
CAS 3037693-01-6 is the registry number for Thalidomide-5-F-6-I. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(3S)-2,6-dioxopiperidin-3-yl]-5-fluoro-6-iodoisoindole-1,3-dione (CAS 3037693-01-6) is a chemical compound with the molecular formula C13H8FIN2O4 and a molecular weight of 402.12 g/mol. IUPAC name: 2-[(3S)-2,6-dioxopiperidin-3-yl]-5-fluoro-6-iodoisoindole-1,3-dione. InChIKey: QFSCSHCESKTHGH-VIFPVBQESA-N.
| Molecular formula | C13H8FIN2O4 |
|---|---|
| Molecular weight | 402.12 g/mol |
| IUPAC name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-5-fluoro-6-iodoisoindole-1,3-dione |
| InChIKey | QFSCSHCESKTHGH-VIFPVBQESA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2C(=O)C3=CC(=C(C=C3C2=O)I)F |
Computed by PubChem (NCBI)