CAS 303771-25-7 is the registry number for N-(4-iodophenyl)(3-methylphenyl)formamide. Offered by: Biosynth. Available pack sizes: 1g, 2g, 5g, 25g, 10g.
N-(4-iodophenyl)-3-methylbenzamide (CAS 303771-25-7) is a chemical compound with the molecular formula C14H12INO and a molecular weight of 337.15 g/mol. IUPAC name: N-(4-iodophenyl)-3-methylbenzamide. InChIKey: STPGMGRARZZPSI-UHFFFAOYSA-N.
| Molecular formula | C14H12INO |
|---|---|
| Molecular weight | 337.15 g/mol |
| IUPAC name | N-(4-iodophenyl)-3-methylbenzamide |
| InChIKey | STPGMGRARZZPSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)