Products 3037847-72-3
CAS 3037847-72-3 is the registry number for FXR agonist 3, 96.51%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10mM/1mL, 100 mg, 50 mg, 10 mg, 5 mg.
2,3,10-trimethoxy-9-[(3-methylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide (CAS 3037847-72-3) is a chemical compound with the molecular formula C28H28BrNO4 and a molecular weight of 522.4 g/mol. IUPAC name: 2,3,10-trimethoxy-9-[(3-methylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide. InChIKey: ZJDFWYFAYRTEHX-UHFFFAOYSA-M.
| Molecular formula | C28H28BrNO4 |
|---|---|
| Molecular weight | 522.4 g/mol |
| IUPAC name | 2,3,10-trimethoxy-9-[(3-methylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide |
| InChIKey | ZJDFWYFAYRTEHX-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC=C1)COC2=C(C=CC3=CC4=[N+](CCC5=CC(=C(C=C54)OC)OC)C=C32)OC.[Br-] |
Computed by PubChem (NCBI)
Synonyms:
FXR agonist 3, orb1982428