CAS 303791-46-0 is the registry number for 3,5-Dichloro-7-iodochromane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dichloro-7-iodo-3,4-dihydro-2H-chromene (CAS 303791-46-0) is a chemical compound with the molecular formula C9H7Cl2IO and a molecular weight of 328.96 g/mol. IUPAC name: 3,5-dichloro-7-iodo-3,4-dihydro-2H-chromene. InChIKey: XDWQKKZZJJRVOC-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2IO |
|---|---|
| Molecular weight | 328.96 g/mol |
| IUPAC name | 3,5-dichloro-7-iodo-3,4-dihydro-2H-chromene |
| InChIKey | XDWQKKZZJJRVOC-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C(=CC(=C2)I)Cl)Cl |
Computed by PubChem (NCBI)