CAS 303793-47-7 is the registry number for 6,8-Dibromo-2-phenyl-quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6,8-dibromo-2-phenylquinoline-4-carboxylic acid (CAS 303793-47-7) is a chemical compound with the molecular formula C16H9Br2NO2 and a molecular weight of 407.06 g/mol. IUPAC name: 6,8-dibromo-2-phenylquinoline-4-carboxylic acid. InChIKey: XKEHMDIRAABOTH-UHFFFAOYSA-N.
| Molecular formula | C16H9Br2NO2 |
|---|---|
| Molecular weight | 407.06 g/mol |
| IUPAC name | 6,8-dibromo-2-phenylquinoline-4-carboxylic acid |
| InChIKey | XKEHMDIRAABOTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=C(C=C3Br)Br)C(=C2)C(=O)O |
Computed by PubChem (NCBI)