CAS 3038254-37-1 is the registry number for 2',6'-Bis(benzyloxy)-3-fluoro-5-iodo-6-methyl-2,3'-bipyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-[2,6-bis(phenylmethoxy)-3-pyridinyl]-3-fluoro-5-iodo-6-methylpyridine (CAS 3038254-37-1) is a chemical compound with the molecular formula C25H20FIN2O2 and a molecular weight of 526.3 g/mol. IUPAC name: 2-[2,6-bis(phenylmethoxy)-3-pyridinyl]-3-fluoro-5-iodo-6-methylpyridine. InChIKey: DPZUAZFBEZKNDW-UHFFFAOYSA-N.
| Molecular formula | C25H20FIN2O2 |
|---|---|
| Molecular weight | 526.3 g/mol |
| IUPAC name | 2-[2,6-bis(phenylmethoxy)-3-pyridinyl]-3-fluoro-5-iodo-6-methylpyridine |
| InChIKey | DPZUAZFBEZKNDW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=N1)C2=C(N=C(C=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)F)I |
Computed by PubChem (NCBI)