CAS 3038323-12-2 is the registry number for PPARγ-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[4-[2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyethoxy]-3-methoxyphenyl]prop-2-enoic acid (CAS 3038323-12-2) is a chemical compound with the molecular formula C22H23ClO7 and a molecular weight of 434.9 g/mol. IUPAC name: (E)-3-[4-[2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyethoxy]-3-methoxyphenyl]prop-2-enoic acid. InChIKey: KKRNFODXVWPDRT-VZUCSPMQSA-N.
| Molecular formula | C22H23ClO7 |
|---|---|
| Molecular weight | 434.9 g/mol |
| IUPAC name | (E)-3-[4-[2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxyethoxy]-3-methoxyphenyl]prop-2-enoic acid |
| InChIKey | KKRNFODXVWPDRT-VZUCSPMQSA-N |
| SMILES | CC(C)(C(=O)OCCOC1=C(C=C(C=C1)/C=C/C(=O)O)OC)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)