CAS 3038464-68-2 is the registry number for NMDAR antagonist 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5R)-5-phenyl-5-pyrrolidin-1-yl-1,4,6,7-tetrahydroindazole (CAS 3038464-68-2) is a chemical compound with the molecular formula C17H21N3 and a molecular weight of 267.37 g/mol. IUPAC name: (5R)-5-phenyl-5-pyrrolidin-1-yl-1,4,6,7-tetrahydroindazole. InChIKey: NIXVFLRRMGVMBF-QGZVFWFLSA-N.
| Molecular formula | C17H21N3 |
|---|---|
| Molecular weight | 267.37 g/mol |
| IUPAC name | (5R)-5-phenyl-5-pyrrolidin-1-yl-1,4,6,7-tetrahydroindazole |
| InChIKey | NIXVFLRRMGVMBF-QGZVFWFLSA-N |
| SMILES | C1CCN(C1)[C@@]2(CCC3=C(C2)C=NN3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)