CAS 30392-41-7 appears in our catalog under these names: Bitolterol Mesylate, >95% (HPLC), Bitolterol mesylate, Bitolterol mesylate, Bitolterol (mesylate), 98.51%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 25mg, 5mg, 10mg, 50mg, 100mg, 5 mg.
[4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;methanesulfonic acid (CAS 30392-41-7) is a chemical compound with the molecular formula C29H35NO8S and a molecular weight of 557.7 g/mol. IUPAC name: [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;methanesulfonic acid. InChIKey: HODFCFXCOMKRCG-UHFFFAOYSA-N.
| Molecular formula | C29H35NO8S |
|---|---|
| Molecular weight | 557.7 g/mol |
| IUPAC name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;methanesulfonic acid |
| InChIKey | HODFCFXCOMKRCG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC2=C(C=C(C=C2)C(CNC(C)(C)C)O)OC(=O)C3=CC=C(C=C3)C.CS(=O)(=O)O |
Computed by PubChem (NCBI)