Products 3041047-51-9
CAS 3041047-51-9 is the registry number for PF-07957472, 99.13%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 50 mg, 10 mg.
2-methyl-5-(4-methylpiperazin-1-yl)-N-[1-[2-(1-methylpyrazol-4-yl)quinolin-4-yl]cyclopropyl]benzamide (CAS 3041047-51-9) is a chemical compound with the molecular formula C29H32N6O and a molecular weight of 480.6 g/mol. IUPAC name: 2-methyl-5-(4-methylpiperazin-1-yl)-N-[1-[2-(1-methylpyrazol-4-yl)quinolin-4-yl]cyclopropyl]benzamide. InChIKey: MMVYUHFDLZLNDJ-UHFFFAOYSA-N.
| Molecular formula | C29H32N6O |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | 2-methyl-5-(4-methylpiperazin-1-yl)-N-[1-[2-(1-methylpyrazol-4-yl)quinolin-4-yl]cyclopropyl]benzamide |
| InChIKey | MMVYUHFDLZLNDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2CCN(CC2)C)C(=O)NC3(CC3)C4=CC(=NC5=CC=CC=C54)C6=CN(N=C6)C |
Computed by PubChem (NCBI)
Synonyms:
orb2665015, compound 4 [Garnsey et al., 2024]