CAS 3042934-03-9 is the registry number for 2-Bromo-3',5,5'-tri-tert-butyl-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-4-tert-butyl-2-(3,5-ditert-butylphenyl)benzene (CAS 3042934-03-9) is a chemical compound with the molecular formula C24H33Br and a molecular weight of 401.4 g/mol. IUPAC name: 1-bromo-4-tert-butyl-2-(3,5-ditert-butylphenyl)benzene. InChIKey: KEDWDNZAWHPBLX-UHFFFAOYSA-N.
| Molecular formula | C24H33Br |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 1-bromo-4-tert-butyl-2-(3,5-ditert-butylphenyl)benzene |
| InChIKey | KEDWDNZAWHPBLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)Br)C2=CC(=CC(=C2)C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)