CAS 3043790-15-1 is the registry number for LDHA-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-(1-methylimidazole-2-carbonyl)anilino]-4-oxo-2-[4-(trifluoromethyl)phenyl]butanoic acid (CAS 3043790-15-1) is a chemical compound with the molecular formula C22H18F3N3O4 and a molecular weight of 445.4 g/mol. IUPAC name: 4-[4-(1-methylimidazole-2-carbonyl)anilino]-4-oxo-2-[4-(trifluoromethyl)phenyl]butanoic acid. InChIKey: CKZMQSBTVXPZGS-UHFFFAOYSA-N.
| Molecular formula | C22H18F3N3O4 |
|---|---|
| Molecular weight | 445.4 g/mol |
| IUPAC name | 4-[4-(1-methylimidazole-2-carbonyl)anilino]-4-oxo-2-[4-(trifluoromethyl)phenyl]butanoic acid |
| InChIKey | CKZMQSBTVXPZGS-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C(=O)C2=CC=C(C=C2)NC(=O)CC(C3=CC=C(C=C3)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)