CAS 3043790-18-4 is the registry number for LDHA-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-[4-(1-methylimidazole-2-carbonyl)anilino]-4-oxo-2-[4-(trifluoromethyl)phenyl]butanoate (CAS 3043790-18-4) is a chemical compound with the molecular formula C23H20F3N3O4 and a molecular weight of 459.4 g/mol. IUPAC name: methyl 4-[4-(1-methylimidazole-2-carbonyl)anilino]-4-oxo-2-[4-(trifluoromethyl)phenyl]butanoate. InChIKey: VGUPNHASVBYZOM-UHFFFAOYSA-N.
| Molecular formula | C23H20F3N3O4 |
|---|---|
| Molecular weight | 459.4 g/mol |
| IUPAC name | methyl 4-[4-(1-methylimidazole-2-carbonyl)anilino]-4-oxo-2-[4-(trifluoromethyl)phenyl]butanoate |
| InChIKey | VGUPNHASVBYZOM-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C(=O)C2=CC=C(C=C2)NC(=O)CC(C3=CC=C(C=C3)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)