CAS 3043952-13-9 is the registry number for NLRP3-IN-72. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[[ethyl(methyl)amino]methyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-1,3-benzoxazol-2-amine (CAS 3043952-13-9) is a chemical compound with the molecular formula C19H20FN5O and a molecular weight of 353.4 g/mol. IUPAC name: 5-[[ethyl(methyl)amino]methyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-1,3-benzoxazol-2-amine. InChIKey: DWKKGXDLSNMYBL-UHFFFAOYSA-N.
| Molecular formula | C19H20FN5O |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 5-[[ethyl(methyl)amino]methyl]-N-(5-fluoro-1-methylbenzimidazol-2-yl)-1,3-benzoxazol-2-amine |
| InChIKey | DWKKGXDLSNMYBL-UHFFFAOYSA-N |
| SMILES | CCN(C)CC1=CC2=C(C=C1)OC(=N2)NC3=NC4=C(N3C)C=CC(=C4)F |
Computed by PubChem (NCBI)