CAS 3044095-82-8 appears in our catalog under these names: 1,7-Diphenylisoquinoline, 98%, 98%, 1,7-Diphenylisoquinoline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
1,7-diphenylisoquinoline (CAS 3044095-82-8) is a chemical compound with the molecular formula C21H15N and a molecular weight of 281.3 g/mol. IUPAC name: 1,7-diphenylisoquinoline. InChIKey: LYUPWEKUBJGALT-UHFFFAOYSA-N.
| Molecular formula | C21H15N |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 1,7-diphenylisoquinoline |
| InChIKey | LYUPWEKUBJGALT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)C=CN=C3C4=CC=CC=C4 |
Computed by PubChem (NCBI)