Products 1039-51-6
CAS 1039-51-6 is the registry number for 2,4-Diphenylquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
2,4-diphenylquinoline (CAS 1039-51-6) is a chemical compound with the molecular formula C21H15N and a molecular weight of 281.3 g/mol. IUPAC name: 2,4-diphenylquinoline. InChIKey: VCOKQFQTBUEGIO-UHFFFAOYSA-N.
| Molecular formula | C21H15N |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 2,4-diphenylquinoline |
| InChIKey | VCOKQFQTBUEGIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)