CAS 304441-05-2 appears in our catalog under these names: Azathioprine Impurity 15, 9-Acetylazathioprine (9-Acetyl-6-((1-methyl-4-nitroimidazol-5-yl)thio)purine). Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
1-[6-(3-methyl-5-nitroimidazol-4-yl)sulfanylpurin-9-yl]ethanone (CAS 304441-05-2) is a chemical compound with the molecular formula C11H9N7O3S and a molecular weight of 319.30 g/mol. IUPAC name: 1-[6-(3-methyl-5-nitroimidazol-4-yl)sulfanylpurin-9-yl]ethanone. InChIKey: KTKDAQHNMYTRJO-UHFFFAOYSA-N.
| Molecular formula | C11H9N7O3S |
|---|---|
| Molecular weight | 319.30 g/mol |
| IUPAC name | 1-[6-(3-methyl-5-nitroimidazol-4-yl)sulfanylpurin-9-yl]ethanone |
| InChIKey | KTKDAQHNMYTRJO-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=NC2=C1N=CN=C2SC3=C(N=CN3C)[N+](=O)[O-] |
Computed by PubChem (NCBI)