CAS 304481-72-9 appears in our catalog under these names: Pkumdl-wq-2101, 95%, PKUMDL-WQ-2101/ 99.28% (existing batch purity), PKUMDL WQ 2101, PKUMDL WQ 2101, PKUMDL-WQ-2101 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 5mg, 10 mg, 100 mg, 25 mg.
2,4-dihydroxy-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]benzamide (CAS 304481-72-9) is a chemical compound with the molecular formula C14H11N3O6 and a molecular weight of 317.25 g/mol. IUPAC name: 2,4-dihydroxy-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]benzamide. InChIKey: OXONIXZPWKJHMW-VIZOYTHASA-N.
| Molecular formula | C14H11N3O6 |
|---|---|
| Molecular weight | 317.25 g/mol |
| IUPAC name | 2,4-dihydroxy-N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]benzamide |
| InChIKey | OXONIXZPWKJHMW-VIZOYTHASA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])/C=N/NC(=O)C2=C(C=C(C=C2)O)O)O |
Computed by PubChem (NCBI)