CAS 30461-28-0 is the registry number for Rel-(3S,4S)-4-aminotetrahydrothiophen-3-ol hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4S)-4-aminothiolan-3-ol;hydrochloride (CAS 30461-28-0) is a chemical compound with the molecular formula C4H10ClNOS and a molecular weight of 155.65 g/mol. IUPAC name: (3S,4S)-4-aminothiolan-3-ol;hydrochloride. InChIKey: XYEGUFCZWYSGAI-VKKIDBQXSA-N.
| Molecular formula | C4H10ClNOS |
|---|---|
| Molecular weight | 155.65 g/mol |
| IUPAC name | (3S,4S)-4-aminothiolan-3-ol;hydrochloride |
| InChIKey | XYEGUFCZWYSGAI-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CS1)O)N.Cl |
Computed by PubChem (NCBI)