CAS 3046118-64-0 is the registry number for Antitumor agent-200. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-fluoro-N-[(3-hydroxy-4-methylselanylphenyl)methyl]-2-morpholin-4-ylbenzamide (CAS 3046118-64-0) is a chemical compound with the molecular formula C19H21FN2O3Se and a molecular weight of 423.4 g/mol. IUPAC name: 5-fluoro-N-[(3-hydroxy-4-methylselanylphenyl)methyl]-2-morpholin-4-ylbenzamide. InChIKey: JFAZUEOREPPLTF-UHFFFAOYSA-N.
| Molecular formula | C19H21FN2O3Se |
|---|---|
| Molecular weight | 423.4 g/mol |
| IUPAC name | 5-fluoro-N-[(3-hydroxy-4-methylselanylphenyl)methyl]-2-morpholin-4-ylbenzamide |
| InChIKey | JFAZUEOREPPLTF-UHFFFAOYSA-N |
| SMILES | C[Se]C1=C(C=C(C=C1)CNC(=O)C2=C(C=CC(=C2)F)N3CCOCC3)O |
Computed by PubChem (NCBI)