CAS 304655-80-9 appears in our catalog under these names: Chloramine B Hydrate, Chloramine B Hydrate, >80.0%(T), N-Chlorobenzenesulfonamide sodium salt hydrate, 80.0%(T), 80.0%(T). Offered by: GLPBio, TCI, Chemat. Available pack sizes: 100g, 500g, 25g.
CAS 304655-80-9 identifies a chemical compound with the molecular formula C6H8ClNNaO3S and a molecular weight of 232.64 g/mol. InChIKey: RRFGOIVHQJFLKL-UHFFFAOYSA-N.
| Molecular formula | C6H8ClNNaO3S |
|---|---|
| Molecular weight | 232.64 g/mol |
| InChIKey | RRFGOIVHQJFLKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NCl.O.[Na] |
Computed by PubChem (NCBI)