Products 304666-03-3

CAS 304666-03-3 is the registry number for 4-(2-(4-Nitrobenzoyl)hydrazinyl)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[2-(4-nitrobenzoyl)hydrazinyl]-4-oxobutanoic acid (CAS 304666-03-3) is a chemical compound with the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. IUPAC name: 4-[2-(4-nitrobenzoyl)hydrazinyl]-4-oxobutanoic acid. InChIKey: JDZIORQQWHFDKH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O6
Molecular weight281.22 g/mol
IUPAC name4-[2-(4-nitrobenzoyl)hydrazinyl]-4-oxobutanoic acid
InChIKeyJDZIORQQWHFDKH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)NNC(=O)CCC(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)