Products 304667-51-4
CAS 304667-51-4 is the registry number for N-(4-bromo-3-chlorophenyl)-4-methylbenzenesulfonamide, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-(4-bromo-3-chlorophenyl)-4-methylbenzenesulfonamide (CAS 304667-51-4) is a chemical compound with the molecular formula C13H11BrClNO2S and a molecular weight of 360.65 g/mol. IUPAC name: N-(4-bromo-3-chlorophenyl)-4-methylbenzenesulfonamide. InChIKey: PEAHMAMASZZAPP-UHFFFAOYSA-N.
| Molecular formula | C13H11BrClNO2S |
|---|---|
| Molecular weight | 360.65 g/mol |
| IUPAC name | N-(4-bromo-3-chlorophenyl)-4-methylbenzenesulfonamide |
| InChIKey | PEAHMAMASZZAPP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)