CAS 304668-39-1 is the registry number for N-(4-Iodophenyl)-4-methoxybenzamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
N-(4-iodophenyl)-4-methoxybenzamide (CAS 304668-39-1) is a chemical compound with the molecular formula C14H12INO2 and a molecular weight of 353.15 g/mol. IUPAC name: N-(4-iodophenyl)-4-methoxybenzamide. InChIKey: RKYRTYUWYQIOBL-UHFFFAOYSA-N.
| Molecular formula | C14H12INO2 |
|---|---|
| Molecular weight | 353.15 g/mol |
| IUPAC name | N-(4-iodophenyl)-4-methoxybenzamide |
| InChIKey | RKYRTYUWYQIOBL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)