CAS 304675-74-9 appears in our catalog under these names: Sodium 4–vinylbenzenesulfonate hydrate, Sodium 4-vinylbenzenesulfonate hydrate, 98%, 98%, Sodium 4-vinylbenzenesulfonate hydrate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 1kg, 2.5kg, 5g, 25g.
Sodium;4-ethenylbenzenesulfonate;hydrate (CAS 304675-74-9) is a chemical compound with the molecular formula C8H9NaO4S and a molecular weight of 224.21 g/mol. IUPAC name: sodium;4-ethenylbenzenesulfonate;hydrate. InChIKey: AATHLPHPRXGBAI-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO4S |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | sodium;4-ethenylbenzenesulfonate;hydrate |
| InChIKey | AATHLPHPRXGBAI-UHFFFAOYSA-M |
| SMILES | C=CC1=CC=C(C=C1)S(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)