CAS 304851-99-8 is the registry number for Sodium propane-2-sulfonate hydrate, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Sodium;propane-2-sulfonate;hydrate (CAS 304851-99-8) is a chemical compound with the molecular formula C3H9NaO4S and a molecular weight of 164.16 g/mol. IUPAC name: sodium;propane-2-sulfonate;hydrate. InChIKey: GZPDXHNILFWYEV-UHFFFAOYSA-M.
| Molecular formula | C3H9NaO4S |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | sodium;propane-2-sulfonate;hydrate |
| InChIKey | GZPDXHNILFWYEV-UHFFFAOYSA-M |
| SMILES | CC(C)S(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)