CAS 304854-40-8 is the registry number for 8-Fluoro-4,4-dimethyl-1H-benzo[d][1,3]oxazin-2(4H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
8-fluoro-4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 304854-40-8) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: 8-fluoro-4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: KGGCHFAUEBWYDP-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | 8-fluoro-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | KGGCHFAUEBWYDP-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC=C2)F)NC(=O)O1)C |
Computed by PubChem (NCBI)