Products 3049339-96-7
CAS 3049339-96-7 is the registry number for Gpr35 modulator 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[4-fluoro-3-[[4-(phenylmethoxymethyl)phenyl]carbamoyl]phenyl]-2-methylpyridine-3-carboxylic acid (CAS 3049339-96-7) is a chemical compound with the molecular formula C28H23FN2O4 and a molecular weight of 470.5 g/mol. IUPAC name: 5-[4-fluoro-3-[[4-(phenylmethoxymethyl)phenyl]carbamoyl]phenyl]-2-methylpyridine-3-carboxylic acid. InChIKey: HUCAGERATMDXMH-UHFFFAOYSA-N.
| Molecular formula | C28H23FN2O4 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | 5-[4-fluoro-3-[[4-(phenylmethoxymethyl)phenyl]carbamoyl]phenyl]-2-methylpyridine-3-carboxylic acid |
| InChIKey | HUCAGERATMDXMH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)C2=CC(=C(C=C2)F)C(=O)NC3=CC=C(C=C3)COCC4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)