CAS 3049368-51-3 is the registry number for ZTA-261, 99.94%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
2-[4-[(4-hydroxynaphthalen-1-yl)methyl]-3,5-bis(trifluoromethyl)phenyl]acetic acid (CAS 3049368-51-3) is a chemical compound with the molecular formula C21H14F6O3 and a molecular weight of 428.3 g/mol. IUPAC name: 2-[4-[(4-hydroxynaphthalen-1-yl)methyl]-3,5-bis(trifluoromethyl)phenyl]acetic acid. InChIKey: XXYOPLPJJQCEJQ-UHFFFAOYSA-N.
| Molecular formula | C21H14F6O3 |
|---|---|
| Molecular weight | 428.3 g/mol |
| IUPAC name | 2-[4-[(4-hydroxynaphthalen-1-yl)methyl]-3,5-bis(trifluoromethyl)phenyl]acetic acid |
| InChIKey | XXYOPLPJJQCEJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)CC3=C(C=C(C=C3C(F)(F)F)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)