CAS 30494-97-4 appears in our catalog under these names: 4–(Chloromethyl)–2–phenyloxazole, 4-(Chloromethyl)-2-phenyl-1,3-oxazole, >95% (HPLC). Offered by: GLPBio, TRC. Available pack sizes: 100mg, 250mg, 25mg, 50mg.
4-(chloromethyl)-2-phenyl-1,3-oxazole (CAS 30494-97-4) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 4-(chloromethyl)-2-phenyl-1,3-oxazole. InChIKey: ANSKJZIDWXDAJW-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 4-(chloromethyl)-2-phenyl-1,3-oxazole |
| InChIKey | ANSKJZIDWXDAJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)CCl |
Computed by PubChem (NCBI)