CAS 3050-88-2 appears in our catalog under these names: Tris(4-nonylphenyl) phosphite, 95%, Tris(4-Nonylphenyl)-Phosphite, TRIS(NONYLPHENYL) PHOSPHITE, Tris(nonylphenyl) phosphite, Tris-(4-monononylphenyl)-phosphite. Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 1g, on request, 500g, 250g, 1000g.
Tris(4-nonylphenyl) phosphite (CAS 3050-88-2) is a chemical compound with the molecular formula C45H69O3P and a molecular weight of 689.0 g/mol. IUPAC name: tris(4-nonylphenyl) phosphite. InChIKey: MGMXGCZJYUCMGY-UHFFFAOYSA-N.
| Molecular formula | C45H69O3P |
|---|---|
| Molecular weight | 689.0 g/mol |
| IUPAC name | tris(4-nonylphenyl) phosphite |
| InChIKey | MGMXGCZJYUCMGY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC1=CC=C(C=C1)OP(OC2=CC=C(C=C2)CCCCCCCCC)OC3=CC=C(C=C3)CCCCCCCCC |
Computed by PubChem (NCBI)