CAS 3050831-84-7 is the registry number for ALK/PI3K/AKT-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4-fluorophenyl)-3-[5-(4-oxo-3-propylquinazolin-6-yl)-1,3-benzothiazol-2-yl]urea (CAS 3050831-84-7) is a chemical compound with the molecular formula C25H20FN5O2S and a molecular weight of 473.5 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-[5-(4-oxo-3-propylquinazolin-6-yl)-1,3-benzothiazol-2-yl]urea. InChIKey: UMJULCZTYVXICB-UHFFFAOYSA-N.
| Molecular formula | C25H20FN5O2S |
|---|---|
| Molecular weight | 473.5 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-[5-(4-oxo-3-propylquinazolin-6-yl)-1,3-benzothiazol-2-yl]urea |
| InChIKey | UMJULCZTYVXICB-UHFFFAOYSA-N |
| SMILES | CCCN1C=NC2=C(C1=O)C=C(C=C2)C3=CC4=C(C=C3)SC(=N4)NC(=O)NC5=CC=C(C=C5)F |
Computed by PubChem (NCBI)