Products 30511-20-7
CAS 30511-20-7 is the registry number for ethyl 2-nitrilo-2-(2-hydroxy-1,3-dioxoindan-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 5000mg.
Ethyl 2-cyano-2-(2-hydroxy-1,3-dioxoinden-2-yl)acetate (CAS 30511-20-7) is a chemical compound with the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. IUPAC name: ethyl 2-cyano-2-(2-hydroxy-1,3-dioxoinden-2-yl)acetate. InChIKey: XIPOAJOTHUHEMY-UHFFFAOYSA-N.
| Molecular formula | C14H11NO5 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | ethyl 2-cyano-2-(2-hydroxy-1,3-dioxoinden-2-yl)acetate |
| InChIKey | XIPOAJOTHUHEMY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)C1(C(=O)C2=CC=CC=C2C1=O)O |
Computed by PubChem (NCBI)