CAS 3051861-49-2 is the registry number for Bcl-2-IN-24. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(2-chloro-5-fluorophenyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one (CAS 3051861-49-2) is a chemical compound with the molecular formula C17H11ClFN3O and a molecular weight of 327.7 g/mol. IUPAC name: (E)-3-(2-chloro-5-fluorophenyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one. InChIKey: FHZCUKLIKLCLGR-FPYGCLRLSA-N.
| Molecular formula | C17H11ClFN3O |
|---|---|
| Molecular weight | 327.7 g/mol |
| IUPAC name | (E)-3-(2-chloro-5-fluorophenyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one |
| InChIKey | FHZCUKLIKLCLGR-FPYGCLRLSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C2=C(C=CC(=C2)F)Cl)N3C=NC=N3 |
Computed by PubChem (NCBI)