CAS 305336-60-1 appears in our catalog under these names: 5-[(2,4-Dichlorophenoxy)methyl]-4-ethyl-4h-1,2,4-triazole-3-thiol, 95%, 5-((2,4-Dichlorophenoxy)methyl)-4-ethyl-4H-1,2,4-triazole-3-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(2,4-dichlorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione (CAS 305336-60-1) is a chemical compound with the molecular formula C11H11Cl2N3OS and a molecular weight of 304.2 g/mol. IUPAC name: 3-[(2,4-dichlorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione. InChIKey: USHGSLFXEXZTBJ-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3OS |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 3-[(2,4-dichlorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione |
| InChIKey | USHGSLFXEXZTBJ-UHFFFAOYSA-N |
| SMILES | CCN1C(=NNC1=S)COC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)