CAS 305337-17-1 is the registry number for N-(3,4-dichlorophenyl)(4-(2-furylcarbonyl)piperazinyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3,4-dichlorophenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide (CAS 305337-17-1) is a chemical compound with the molecular formula C16H15Cl2N3O3 and a molecular weight of 368.2 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide. InChIKey: CUXTZZNDENTSKN-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2N3O3 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide |
| InChIKey | CUXTZZNDENTSKN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)C2=CC=CO2)C(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)