CAS 305371-45-3 is the registry number for 4,6-Dichloro-1,7-naphthyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4,6-dichloro-1,7-naphthyridine-3-carbonitrile (CAS 305371-45-3) is a chemical compound with the molecular formula C9H3Cl2N3 and a molecular weight of 224.04 g/mol. IUPAC name: 4,6-dichloro-1,7-naphthyridine-3-carbonitrile. InChIKey: OKYQWZDOLIYAHN-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2N3 |
|---|---|
| Molecular weight | 224.04 g/mol |
| IUPAC name | 4,6-dichloro-1,7-naphthyridine-3-carbonitrile |
| InChIKey | OKYQWZDOLIYAHN-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)N=CC(=C2Cl)C#N |
Computed by PubChem (NCBI)