Products 3053753-61-7
CAS 3053753-61-7 is the registry number for SARS-CoV-2 PLpro-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(6-methoxy-3-pyridinyl)-N-[(3R)-pyrrolidin-3-yl]-1,5-naphthyridin-4-amine (CAS 3053753-61-7) is a chemical compound with the molecular formula C18H19N5O and a molecular weight of 321.4 g/mol. IUPAC name: 6-(6-methoxy-3-pyridinyl)-N-[(3R)-pyrrolidin-3-yl]-1,5-naphthyridin-4-amine. InChIKey: DEUIPJITGWQDKC-CYBMUJFWSA-N.
| Molecular formula | C18H19N5O |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 6-(6-methoxy-3-pyridinyl)-N-[(3R)-pyrrolidin-3-yl]-1,5-naphthyridin-4-amine |
| InChIKey | DEUIPJITGWQDKC-CYBMUJFWSA-N |
| SMILES | COC1=NC=C(C=C1)C2=NC3=C(C=CN=C3C=C2)N[C@@H]4CCNC4 |
Computed by PubChem (NCBI)
Synonyms:
SARS-CoV-2 PLpro-IN-1, orb2945637