CAS 3054159-56-4 is the registry number for hCA I-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
11-[(1-pyridin-3-yltriazol-4-yl)methyl]benzo[b][1]benzazepine (CAS 3054159-56-4) is a chemical compound with the molecular formula C22H17N5 and a molecular weight of 351.4 g/mol. IUPAC name: 11-[(1-pyridin-3-yltriazol-4-yl)methyl]benzo[b][1]benzazepine. InChIKey: IPVSWXYYKHOWJW-UHFFFAOYSA-N.
| Molecular formula | C22H17N5 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 11-[(1-pyridin-3-yltriazol-4-yl)methyl]benzo[b][1]benzazepine |
| InChIKey | IPVSWXYYKHOWJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2CC4=CN(N=N4)C5=CN=CC=C5 |
Computed by PubChem (NCBI)