Products 3055022-23-3
CAS 3055022-23-3 is the registry number for (Rac)-AAA, 99.02%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 500 μg.
Disodium;2-[[(6Z,15Z)-20-hydroxyicosa-6,15-dienoyl]amino]butanedioate (CAS 3055022-23-3) is a chemical compound with the molecular formula C24H39NNa2O6 and a molecular weight of 483.5 g/mol. IUPAC name: disodium;2-[[(6Z,15Z)-20-hydroxyicosa-6,15-dienoyl]amino]butanedioate. InChIKey: JGVHCBALWPPEGB-UJJOPKMPSA-L.
| Molecular formula | C24H39NNa2O6 |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | disodium;2-[[(6Z,15Z)-20-hydroxyicosa-6,15-dienoyl]amino]butanedioate |
| InChIKey | JGVHCBALWPPEGB-UJJOPKMPSA-L |
| SMILES | C(CCC/C=C\CCCCC(=O)NC(CC(=O)[O-])C(=O)[O-])CCC/C=C\CCCCO.[Na+].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
AAA, orb1694258