Products 3055292-24-2

CAS 3055292-24-2 is the registry number for 1-Bromo-7-(1,1-dimethylethyl)- dibenzofuran, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-bromo-7-tert-butyldibenzofuran (CAS 3055292-24-2) is a chemical compound with the molecular formula C16H15BrO and a molecular weight of 303.19 g/mol. IUPAC name: 1-bromo-7-tert-butyldibenzofuran. InChIKey: NCJUXHJCFCXHQH-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15BrO
Molecular weight303.19 g/mol
IUPAC name1-bromo-7-tert-butyldibenzofuran
InChIKeyNCJUXHJCFCXHQH-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC2=C(C=C1)C3=C(O2)C=CC=C3Br

Computed by PubChem (NCBI)