CAS 1438391-33-3 appears in our catalog under these names: 4-Bromo-6-(tert-butyl)dibenzo[b,d]furan, 95%, 4-Bromo-6-(tert-butyl)dibenzo[b,d]furan, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
4-bromo-6-tert-butyldibenzofuran (CAS 1438391-33-3) is a chemical compound with the molecular formula C16H15BrO and a molecular weight of 303.19 g/mol. IUPAC name: 4-bromo-6-tert-butyldibenzofuran. InChIKey: RGBGTPGFTMYLTA-UHFFFAOYSA-N.
| Molecular formula | C16H15BrO |
|---|---|
| Molecular weight | 303.19 g/mol |
| IUPAC name | 4-bromo-6-tert-butyldibenzofuran |
| InChIKey | RGBGTPGFTMYLTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC2=C1OC3=C2C=CC=C3Br |
Computed by PubChem (NCBI)