CAS 3055359-30-0 is the registry number for AhR modulator-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(Z)-2-fluoro-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol (CAS 3055359-30-0) is a chemical compound with the molecular formula C17H17FO2 and a molecular weight of 272.31 g/mol. IUPAC name: 5-[(Z)-2-fluoro-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol. InChIKey: QFHSWFIWVIMQQX-ZSOIEALJSA-N.
| Molecular formula | C17H17FO2 |
|---|---|
| Molecular weight | 272.31 g/mol |
| IUPAC name | 5-[(Z)-2-fluoro-2-phenylethenyl]-2-propan-2-ylbenzene-1,3-diol |
| InChIKey | QFHSWFIWVIMQQX-ZSOIEALJSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1O)/C=C(/C2=CC=CC=C2)\F)O |
Computed by PubChem (NCBI)