CAS 3055427-13-6 is the registry number for YS10. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-fluorophenyl)-3-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-1,3-thiazolidin-4-one (CAS 3055427-13-6) is a chemical compound with the molecular formula C19H17FN2O2S and a molecular weight of 356.4 g/mol. IUPAC name: 2-(4-fluorophenyl)-3-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-1,3-thiazolidin-4-one. InChIKey: YCTCPYJVDYHAIC-UHFFFAOYSA-N.
| Molecular formula | C19H17FN2O2S |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-3-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-1,3-thiazolidin-4-one |
| InChIKey | YCTCPYJVDYHAIC-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(S1)C2=CC=C(C=C2)F)CCC3=CNC4=C3C=C(C=C4)O |
Computed by PubChem (NCBI)